C23H17N3O3 — CID 12840853
1-amino-4-anilino-2-(4,5-dihydro-1,3-oxazol-2-yl)anthracene-9,10-dione (PubChem CID 12840853) has the molecular formula C23H17N3O3 and a molecular weight of 383.41 g/mol. Its IUPAC name is 1-amino-4-anilino-2-(4,5-dihydro-1,3-oxazol-2-yl)anthracene-9,10-dione.
| Compound Name | 1-amino-4-anilino-2-(4,5-dihydro-1,3-oxazol-2-yl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 12840853 |
| Molecular Formula | C23H17N3O3 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 1-amino-4-anilino-2-(4,5-dihydro-1,3-oxazol-2-yl)anthracene-9,10-dione |
| SMILES | Nc1c(C2=NCCO2)cc(Nc2ccccc2)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H17N3O3/c24-20-16(23-25-10-11-29-23)12-17(26-13-6-2-1-3-7-13)18-19(20)22(28)15-9-5-4-8-14(15)21(18)27/h1-9,12,26H,10-11,24H2 |
| InChIKey | WPYFRJXKTYWDRX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|