C24H16N2O2 — CID 15531332
6-amino-11-anilinotetracene-5,12-dione (PubChem CID 15531332) has the molecular formula C24H16N2O2 and a molecular weight of 364.40 g/mol. Its IUPAC name is 6-amino-11-anilinotetracene-5,12-dione.
| Compound Name | 6-amino-11-anilinotetracene-5,12-dione |
|---|---|
| PubChem CID | 15531332 |
| Molecular Formula | C24H16N2O2 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 6-amino-11-anilinotetracene-5,12-dione |
| SMILES | Nc1c2c(c(Nc3ccccc3)c3ccccc13)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H16N2O2/c25-21-15-10-4-5-11-16(15)22(26-14-8-2-1-3-9-14)20-19(21)23(27)17-12-6-7-13-18(17)24(20)28/h1-13,26H,25H2 |
| InChIKey | NHCATDKHRFIAFL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'} |
|---|