C20H13ClN2O2 — CID 140996903
1-(4-aminoanilino)-2-chloroanthracene-9,10-dione (PubChem CID 140996903) has the molecular formula C20H13ClN2O2 and a molecular weight of 348.79 g/mol. Its IUPAC name is 1-(4-aminoanilino)-2-chloroanthracene-9,10-dione.
| Compound Name | 1-(4-aminoanilino)-2-chloroanthracene-9,10-dione |
|---|---|
| PubChem CID | 140996903 |
| Molecular Formula | C20H13ClN2O2 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 1-(4-aminoanilino)-2-chloroanthracene-9,10-dione |
| SMILES | Nc1ccc(Nc2c(Cl)ccc3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C20H13ClN2O2/c21-16-10-9-15-17(18(16)23-12-7-5-11(22)6-8-12)20(25)14-4-2-1-3-13(14)19(15)24/h1-10,23H,22H2 |
| InChIKey | ZJHAYVNMDVNNKY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|