C19H22O3 — CID 151802176
2-butyl-3-(2,2-dimethylpropanoyl)naphthalene-1,4-dione (PubChem CID 151802176) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is 2-butyl-3-(2,2-dimethylpropanoyl)naphthalene-1,4-dione.
| Compound Name | 2-butyl-3-(2,2-dimethylpropanoyl)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 151802176 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 2-butyl-3-(2,2-dimethylpropanoyl)naphthalene-1,4-dione |
| SMILES | CCCCC1=C(C(=O)C(C)(C)C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H22O3/c1-5-6-9-14-15(18(22)19(2,3)4)17(21)13-11-8-7-10-12(13)16(14)20/h7-8,10-11H,5-6,9H2,1-4H3 |
| InChIKey | RYVKDWQFRWAYBQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|