C23H22O4 — CID 91896884
ethyl 1,4-dioxo-3-[(4-propylphenyl)methyl]naphthalene-2-carboxylate (PubChem CID 91896884) has the molecular formula C23H22O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is ethyl 1,4-dioxo-3-[(4-propylphenyl)methyl]naphthalene-2-carboxylate.
| Compound Name | ethyl 1,4-dioxo-3-[(4-propylphenyl)methyl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 91896884 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | ethyl 1,4-dioxo-3-[(4-propylphenyl)methyl]naphthalene-2-carboxylate |
| SMILES | CCCc1ccc(CC2=C(C(=O)OCC)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C23H22O4/c1-3-7-15-10-12-16(13-11-15)14-19-20(23(26)27-4-2)22(25)18-9-6-5-8-17(18)21(19)24/h5-6,8-13H,3-4,7,14H2,1-2H3 |
| InChIKey | NHIDBSJWSDETCX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|