C18H22O — CID 100920332
(3aS)-1-hexyl-3a,4-dihydro-3H-cyclopenta[a]inden-2-one (PubChem CID 100920332) has the molecular formula C18H22O and a molecular weight of 254.37 g/mol. Its IUPAC name is (3aS)-1-hexyl-3a,4-dihydro-3H-cyclopenta[a]inden-2-one.
| Compound Name | (3aS)-1-hexyl-3a,4-dihydro-3H-cyclopenta[a]inden-2-one |
|---|---|
| PubChem CID | 100920332 |
| Molecular Formula | C18H22O |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | (3aS)-1-hexyl-3a,4-dihydro-3H-cyclopenta[a]inden-2-one |
| SMILES | CCCCCCC1=C2c3ccccc3C[C@H]2CC1=O |
| InChI | InChI=1S/C18H22O/c1-2-3-4-5-10-16-17(19)12-14-11-13-8-6-7-9-15(13)18(14)16/h6-9,14H,2-5,10-12H2,1H3/t14-/m0/s1 |
| InChIKey | ZSNHGQAAURZLSJ-AWEZNQCLSA-N |
| XLogP | 4.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|