C19H24N2 — CID 176800334
3,7-ditert-butyl-5H-pyrido[4,3-b]indole (PubChem CID 176800334) has the molecular formula C19H24N2 and a molecular weight of 280.42 g/mol. Its IUPAC name is 3,7-ditert-butyl-5H-pyrido[4,3-b]indole.
| Compound Name | 3,7-ditert-butyl-5H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 176800334 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 3,7-ditert-butyl-5H-pyrido[4,3-b]indole |
| SMILES | CC(C)(C)c1ccc2c(c1)[nH]c1cc(C(C)(C)C)ncc12 |
| InChI | InChI=1S/C19H24N2/c1-18(2,3)12-7-8-13-14-11-20-17(19(4,5)6)10-16(14)21-15(13)9-12/h7-11,21H,1-6H3 |
| InChIKey | OLVUEBPJTVFLBK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |