C28H28N2S — CID 102580108
6,20-ditert-butyl-13-thia-3,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),2(10),4(9),5,7,11,14,17(22),18,20-decaene (PubChem CID 102580108) has the molecular formula C28H28N2S and a molecular weight of 424.61 g/mol. Its IUPAC name is 6,20-ditert-butyl-13-thia-3,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),2(10),4(9),5,7,11,14,17(22),18,20-decaene.
| Compound Name | 6,20-ditert-butyl-13-thia-3,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),2(10),4(9),5,7,11,14,17(22),18,20-decaene |
|---|---|
| PubChem CID | 102580108 |
| Molecular Formula | C28H28N2S |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 6,20-ditert-butyl-13-thia-3,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),2(10),4(9),5,7,11,14,17(22),18,20-decaene |
| SMILES | CC(C)(C)c1ccc2c(c1)[nH]c1c3[nH]c4cc(C(C)(C)C)ccc4c3c3cscc3c21 |
| InChI | InChI=1S/C28H28N2S/c1-27(2,3)15-7-9-17-21(11-15)29-25-23(17)19-13-31-14-20(19)24-18-10-8-16(28(4,5)6)12-22(18)30-26(24)25/h7-14,29-30H,1-6H3 |
| InChIKey | HRGZEYOQOVUWRR-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |