C20H11NaO5S — CID 140610885
sodium 4-(9,10-dioxophenanthren-2-yl)benzenesulfonate (PubChem CID 140610885) has the molecular formula C20H11NaO5S and a molecular weight of 386.36 g/mol. Its IUPAC name is sodium 4-(9,10-dioxophenanthren-2-yl)benzenesulfonate.
| Compound Name | sodium 4-(9,10-dioxophenanthren-2-yl)benzenesulfonate |
|---|---|
| PubChem CID | 140610885 |
| Molecular Formula | C20H11NaO5S |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | sodium 4-(9,10-dioxophenanthren-2-yl)benzenesulfonate |
| SMILES | O=C1C(=O)c2cc(-c3ccc(S(=O)(=O)[O-])cc3)ccc2-c2ccccc21.[Na+] |
| InChI | InChI=1S/C20H12O5S.Na/c21-19-17-4-2-1-3-15(17)16-10-7-13(11-18(16)20(19)22)12-5-8-14(9-6-12)26(23,24)25;/h1-11H,(H,23,24,25);/q;+1/p-1 |
| InChIKey | IBQULWCCLZPKNE-UHFFFAOYSA-M |
| XLogP | 0.31 |
| TPSA | 91.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|