C21H26N2O5S2 — CID 1121755
2-N,7-N-ditert-butyl-9-oxofluorene-2,7-disulfonamide (PubChem CID 1121755) has the molecular formula C21H26N2O5S2 and a molecular weight of 450.58 g/mol. Its IUPAC name is 2-N,7-N-ditert-butyl-9-oxofluorene-2,7-disulfonamide.
| Compound Name | 2-N,7-N-ditert-butyl-9-oxofluorene-2,7-disulfonamide |
|---|---|
| PubChem CID | 1121755 |
| Molecular Formula | C21H26N2O5S2 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 2-N,7-N-ditert-butyl-9-oxofluorene-2,7-disulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc2c(c1)C(=O)c1cc(S(=O)(=O)NC(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C21H26N2O5S2/c1-20(2,3)22-29(25,26)13-7-9-15-16-10-8-14(30(27,28)23-21(4,5)6)12-18(16)19(24)17(15)11-13/h7-12,22-23H,1-6H3 |
| InChIKey | WWHWQJZWPJAJNE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |