C16H20N2O2S — CID 3704165
4-propyl-N-(2-pyridin-2-ylethyl)benzenesulfonamide (PubChem CID 3704165) has the molecular formula C16H20N2O2S and a molecular weight of 304.41 g/mol. Its IUPAC name is 4-propyl-N-(2-pyridin-2-ylethyl)benzenesulfonamide.
| Compound Name | 4-propyl-N-(2-pyridin-2-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3704165 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 4-propyl-N-(2-pyridin-2-ylethyl)benzenesulfonamide |
| SMILES | CCCc1ccc(S(=O)(=O)NCCc2ccccn2)cc1 |
| InChI | InChI=1S/C16H20N2O2S/c1-2-5-14-7-9-16(10-8-14)21(19,20)18-13-11-15-6-3-4-12-17-15/h3-4,6-10,12,18H,2,5,11,13H2,1H3 |
| InChIKey | HBQFGBMHOBXUOR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |