C11H7Cl2NO5S2 — CID 107264953
3-[(2,5-dichlorothiophen-3-yl)sulfonylamino]-4-hydroxybenzoic acid (PubChem CID 107264953) has the molecular formula C11H7Cl2NO5S2 and a molecular weight of 368.22 g/mol. Its IUPAC name is 3-[(2,5-dichlorothiophen-3-yl)sulfonylamino]-4-hydroxybenzoic acid.
| Compound Name | 3-[(2,5-dichlorothiophen-3-yl)sulfonylamino]-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 107264953 |
| Molecular Formula | C11H7Cl2NO5S2 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 366.91 |
| IUPAC Name | 3-[(2,5-dichlorothiophen-3-yl)sulfonylamino]-4-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(O)c(NS(=O)(=O)c2cc(Cl)sc2Cl)c1 |
| InChI | InChI=1S/C11H7Cl2NO5S2/c12-9-4-8(10(13)20-9)21(18,19)14-6-3-5(11(16)17)1-2-7(6)15/h1-4,14-15H,(H,16,17) |
| InChIKey | VGEYYSQUQSZBCD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|