C15H16Cl2N2O4S2 — CID 36619450
ethyl 3-[(2,5-dichlorothiophen-3-yl)sulfonylamino]-4-(ethylamino)benzoate (PubChem CID 36619450) has the molecular formula C15H16Cl2N2O4S2 and a molecular weight of 423.34 g/mol. Its IUPAC name is ethyl 3-[(2,5-dichlorothiophen-3-yl)sulfonylamino]-4-(ethylamino)benzoate.
| Compound Name | ethyl 3-[(2,5-dichlorothiophen-3-yl)sulfonylamino]-4-(ethylamino)benzoate |
|---|---|
| PubChem CID | 36619450 |
| Molecular Formula | C15H16Cl2N2O4S2 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | ethyl 3-[(2,5-dichlorothiophen-3-yl)sulfonylamino]-4-(ethylamino)benzoate |
| SMILES | CCNc1ccc(C(=O)OCC)cc1NS(=O)(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C15H16Cl2N2O4S2/c1-3-18-10-6-5-9(15(20)23-4-2)7-11(10)19-25(21,22)12-8-13(16)24-14(12)17/h5-8,18-19H,3-4H2,1-2H3 |
| InChIKey | DNWRDIQDEUBQOM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |