C18H19ClFNO5S — CID 162716369
ethyl 4-[[5-chloro-2-(2-hydroxypropyl)phenyl]sulfonylamino]-3-fluorobenzoate (PubChem CID 162716369) has the molecular formula C18H19ClFNO5S and a molecular weight of 415.87 g/mol. Its IUPAC name is ethyl 4-[[5-chloro-2-(2-hydroxypropyl)phenyl]sulfonylamino]-3-fluorobenzoate.
| Compound Name | ethyl 4-[[5-chloro-2-(2-hydroxypropyl)phenyl]sulfonylamino]-3-fluorobenzoate |
|---|---|
| PubChem CID | 162716369 |
| Molecular Formula | C18H19ClFNO5S |
| Molecular Weight | 415.87 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | ethyl 4-[[5-chloro-2-(2-hydroxypropyl)phenyl]sulfonylamino]-3-fluorobenzoate |
| SMILES | CCOC(=O)c1ccc(NS(=O)(=O)c2cc(Cl)ccc2CC(C)O)c(F)c1 |
| InChI | InChI=1S/C18H19ClFNO5S/c1-3-26-18(23)13-5-7-16(15(20)9-13)21-27(24,25)17-10-14(19)6-4-12(17)8-11(2)22/h4-7,9-11,21-22H,3,8H2,1-2H3 |
| InChIKey | CKJSPPCMAJOJNS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.87 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |