C18H19ClFNO5S — CID 175200275
1-[5-chloro-2-(2-hydroxypropyl)-N-sulfinoanilino]-4-ethoxycarbonyl-2-fluorobenzene (PubChem CID 175200275) has the molecular formula C18H19ClFNO5S and a molecular weight of 415.87 g/mol. Its IUPAC name is 1-[5-chloro-2-(2-hydroxypropyl)-N-sulfinoanilino]-4-ethoxycarbonyl-2-fluorobenzene.
| Compound Name | 1-[5-chloro-2-(2-hydroxypropyl)-N-sulfinoanilino]-4-ethoxycarbonyl-2-fluorobenzene |
|---|---|
| PubChem CID | 175200275 |
| Molecular Formula | C18H19ClFNO5S |
| Molecular Weight | 415.87 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 1-[5-chloro-2-(2-hydroxypropyl)-N-sulfinoanilino]-4-ethoxycarbonyl-2-fluorobenzene |
| SMILES | CCOC(=O)c1ccc(N(c2cc(Cl)ccc2CC(C)O)S(=O)O)c(F)c1 |
| InChI | InChI=1S/C18H19ClFNO5S/c1-3-26-18(23)13-5-7-16(15(20)9-13)21(27(24)25)17-10-14(19)6-4-12(17)8-11(2)22/h4-7,9-11,22H,3,8H2,1-2H3,(H,24,25) |
| InChIKey | YZKBCYQTLVTVOU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.87 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|