C14H22ClN3O3 — CID 119672270
ethyl 4-(ethylamino)-3-[[2-(methylamino)acetyl]amino]benzoate;hydrochloride (PubChem CID 119672270) has the molecular formula C14H22ClN3O3 and a molecular weight of 315.80 g/mol. Its IUPAC name is ethyl 4-(ethylamino)-3-[[2-(methylamino)acetyl]amino]benzoate;hydrochloride.
| Compound Name | ethyl 4-(ethylamino)-3-[[2-(methylamino)acetyl]amino]benzoate;hydrochloride |
|---|---|
| PubChem CID | 119672270 |
| Molecular Formula | C14H22ClN3O3 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | ethyl 4-(ethylamino)-3-[[2-(methylamino)acetyl]amino]benzoate;hydrochloride |
| SMILES | CCNc1ccc(C(=O)OCC)cc1NC(=O)CNC.Cl |
| InChI | InChI=1S/C14H21N3O3.ClH/c1-4-16-11-7-6-10(14(19)20-5-2)8-12(11)17-13(18)9-15-3;/h6-8,15-16H,4-5,9H2,1-3H3,(H,17,18);1H |
| InChIKey | POKBZUSNOSRBEH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |