C17H25N3O3S — CID 119934972
ethyl 4-(ethylamino)-3-[(2-thiomorpholin-3-ylacetyl)amino]benzoate (PubChem CID 119934972) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is ethyl 4-(ethylamino)-3-[(2-thiomorpholin-3-ylacetyl)amino]benzoate.
| Compound Name | ethyl 4-(ethylamino)-3-[(2-thiomorpholin-3-ylacetyl)amino]benzoate |
|---|---|
| PubChem CID | 119934972 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | ethyl 4-(ethylamino)-3-[(2-thiomorpholin-3-ylacetyl)amino]benzoate |
| SMILES | CCNc1ccc(C(=O)OCC)cc1NC(=O)CC1CSCCN1 |
| InChI | InChI=1S/C17H25N3O3S/c1-3-18-14-6-5-12(17(22)23-4-2)9-15(14)20-16(21)10-13-11-24-8-7-19-13/h5-6,9,13,18-19H,3-4,7-8,10-11H2,1-2H3,(H,20,21) |
| InChIKey | RNSATOICSPDOQC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |