C17H26ClN3O3 — CID 119672274
ethyl 3-[[2-(cyclopropylmethylamino)acetyl]amino]-4-(ethylamino)benzoate;hydrochloride (PubChem CID 119672274) has the molecular formula C17H26ClN3O3 and a molecular weight of 355.87 g/mol. Its IUPAC name is ethyl 3-[[2-(cyclopropylmethylamino)acetyl]amino]-4-(ethylamino)benzoate;hydrochloride.
| Compound Name | ethyl 3-[[2-(cyclopropylmethylamino)acetyl]amino]-4-(ethylamino)benzoate;hydrochloride |
|---|---|
| PubChem CID | 119672274 |
| Molecular Formula | C17H26ClN3O3 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | ethyl 3-[[2-(cyclopropylmethylamino)acetyl]amino]-4-(ethylamino)benzoate;hydrochloride |
| SMILES | CCNc1ccc(C(=O)OCC)cc1NC(=O)CNCC1CC1.Cl |
| InChI | InChI=1S/C17H25N3O3.ClH/c1-3-19-14-8-7-13(17(22)23-4-2)9-15(14)20-16(21)11-18-10-12-5-6-12;/h7-9,12,18-19H,3-6,10-11H2,1-2H3,(H,20,21);1H |
| InChIKey | CQNWTAZFKWJEOJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |