C19H24ClN3O3 — CID 119672258
ethyl 3-[[2-(4-aminophenyl)acetyl]amino]-4-(ethylamino)benzoate;hydrochloride (PubChem CID 119672258) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is ethyl 3-[[2-(4-aminophenyl)acetyl]amino]-4-(ethylamino)benzoate;hydrochloride.
| Compound Name | ethyl 3-[[2-(4-aminophenyl)acetyl]amino]-4-(ethylamino)benzoate;hydrochloride |
|---|---|
| PubChem CID | 119672258 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | ethyl 3-[[2-(4-aminophenyl)acetyl]amino]-4-(ethylamino)benzoate;hydrochloride |
| SMILES | CCNc1ccc(C(=O)OCC)cc1NC(=O)Cc1ccc(N)cc1.Cl |
| InChI | InChI=1S/C19H23N3O3.ClH/c1-3-21-16-10-7-14(19(24)25-4-2)12-17(16)22-18(23)11-13-5-8-15(20)9-6-13;/h5-10,12,21H,3-4,11,20H2,1-2H3,(H,22,23);1H |
| InChIKey | JDLSDXXUGRWUGB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|