C18H22BrClN2O3 — CID 119745055
2-(4-aminophenyl)-N-(2-bromo-4,5-diethoxyphenyl)acetamide;hydrochloride (PubChem CID 119745055) has the molecular formula C18H22BrClN2O3 and a molecular weight of 429.74 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-(2-bromo-4,5-diethoxyphenyl)acetamide;hydrochloride.
| Compound Name | 2-(4-aminophenyl)-N-(2-bromo-4,5-diethoxyphenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119745055 |
| Molecular Formula | C18H22BrClN2O3 |
| Molecular Weight | 429.74 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 2-(4-aminophenyl)-N-(2-bromo-4,5-diethoxyphenyl)acetamide;hydrochloride |
| SMILES | CCOc1cc(Br)c(NC(=O)Cc2ccc(N)cc2)cc1OCC.Cl |
| InChI | InChI=1S/C18H21BrN2O3.ClH/c1-3-23-16-10-14(19)15(11-17(16)24-4-2)21-18(22)9-12-5-7-13(20)8-6-12;/h5-8,10-11H,3-4,9,20H2,1-2H3,(H,21,22);1H |
| InChIKey | FHJPEFRGFCZSME-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.74 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|