C9H8ClN3O2S2 — CID 106934935
2-chloro-N-methyl-N-pyridin-4-yl-1,3-thiazole-5-sulfonamide (PubChem CID 106934935) has the molecular formula C9H8ClN3O2S2 and a molecular weight of 289.77 g/mol. Its IUPAC name is 2-chloro-N-methyl-N-pyridin-4-yl-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-chloro-N-methyl-N-pyridin-4-yl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 106934935 |
| Molecular Formula | C9H8ClN3O2S2 |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 288.97 |
| IUPAC Name | 2-chloro-N-methyl-N-pyridin-4-yl-1,3-thiazole-5-sulfonamide |
| SMILES | CN(c1ccncc1)S(=O)(=O)c1cnc(Cl)s1 |
| InChI | InChI=1S/C9H8ClN3O2S2/c1-13(7-2-4-11-5-3-7)17(14,15)8-6-12-9(10)16-8/h2-6H,1H3 |
| InChIKey | YKQAWWNSBZSSBI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |