About N-butyl-1H-1,2,4-triazole-5-sulfonamide
N-butyl-1H-1,2,4-triazole-5-sulfonamide (PubChem CID 595059) has the molecular formula C6H12N4O2S
and a molecular weight of 204.25 g/mol. Its IUPAC name is N-butyl-1H-1,2,4-triazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-butyl-1H-1,2,4-triazole-5-sulfonamide |
| PubChem CID | 595059 |
| Molecular Formula | C6H12N4O2S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | N-butyl-1H-1,2,4-triazole-5-sulfonamide |
| SMILES | CCCCNS(=O)(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C6H12N4O2S/c1-2-3-4-9-13(11,12)6-7-5-8-10-6/h5,9H,2-4H2,1H3,(H,7,8,10) |
| InChIKey | FXMSDLJEAICSOB-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-1H-1,2,4-triazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-1H-1,2,4-triazole-5-sulfonamide?
The IUPAC name of N-butyl-1H-1,2,4-triazole-5-sulfonamide (CID 595059) is N-butyl-1H-1,2,4-triazole-5-sulfonamide.
What is the SMILES notation for N-butyl-1H-1,2,4-triazole-5-sulfonamide?
The canonical SMILES for N-butyl-1H-1,2,4-triazole-5-sulfonamide is CCCCNS(=O)(=O)c1ncn[nH]1.
What is the InChIKey of N-butyl-1H-1,2,4-triazole-5-sulfonamide?
The InChIKey is FXMSDLJEAICSOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4O2S/c1-2-3-4-9-13(11,12)6-7-5-8-10-6/h5,9H,2-4H2,1H3,(H,7,8,10).
What are the key properties of N-butyl-1H-1,2,4-triazole-5-sulfonamide?
N-butyl-1H-1,2,4-triazole-5-sulfonamide has a molecular weight of 204.25 g/mol, XLogP of -0.12, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-1H-1,2,4-triazole-5-sulfonamide is sourced from PubChem (CID 595059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).