C9H15N3O4S — CID 65231275
methyl 3-[2-(1H-imidazol-5-yl)ethylsulfamoyl]propanoate (PubChem CID 65231275) has the molecular formula C9H15N3O4S and a molecular weight of 261.30 g/mol. Its IUPAC name is methyl 3-[2-(1H-imidazol-5-yl)ethylsulfamoyl]propanoate.
| Compound Name | methyl 3-[2-(1H-imidazol-5-yl)ethylsulfamoyl]propanoate |
|---|---|
| PubChem CID | 65231275 |
| Molecular Formula | C9H15N3O4S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | methyl 3-[2-(1H-imidazol-5-yl)ethylsulfamoyl]propanoate |
| SMILES | COC(=O)CCS(=O)(=O)NCCc1cnc[nH]1 |
| InChI | InChI=1S/C9H15N3O4S/c1-16-9(13)3-5-17(14,15)12-4-2-8-6-10-7-11-8/h6-7,12H,2-5H2,1H3,(H,10,11) |
| InChIKey | HRHKBKHZLPRCBU-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |