C7H11N3O4S — CID 65231882
2-[2-(1H-imidazol-5-yl)ethylsulfamoyl]acetic acid (PubChem CID 65231882) has the molecular formula C7H11N3O4S and a molecular weight of 233.25 g/mol. Its IUPAC name is 2-[2-(1H-imidazol-5-yl)ethylsulfamoyl]acetic acid.
| Compound Name | 2-[2-(1H-imidazol-5-yl)ethylsulfamoyl]acetic acid |
|---|---|
| PubChem CID | 65231882 |
| Molecular Formula | C7H11N3O4S |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 2-[2-(1H-imidazol-5-yl)ethylsulfamoyl]acetic acid |
| SMILES | O=C(O)CS(=O)(=O)NCCc1cnc[nH]1 |
| InChI | InChI=1S/C7H11N3O4S/c11-7(12)4-15(13,14)10-2-1-6-3-8-5-9-6/h3,5,10H,1-2,4H2,(H,8,9)(H,11,12) |
| InChIKey | FZMORHJZKTWHBF-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |