C13H14N4O2S — CID 65231409
1-(2-cyanophenyl)-N-[2-(1H-imidazol-5-yl)ethyl]methanesulfonamide (PubChem CID 65231409) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is 1-(2-cyanophenyl)-N-[2-(1H-imidazol-5-yl)ethyl]methanesulfonamide.
| Compound Name | 1-(2-cyanophenyl)-N-[2-(1H-imidazol-5-yl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 65231409 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 1-(2-cyanophenyl)-N-[2-(1H-imidazol-5-yl)ethyl]methanesulfonamide |
| SMILES | N#Cc1ccccc1CS(=O)(=O)NCCc1cnc[nH]1 |
| InChI | InChI=1S/C13H14N4O2S/c14-7-11-3-1-2-4-12(11)9-20(18,19)17-6-5-13-8-15-10-16-13/h1-4,8,10,17H,5-6,9H2,(H,15,16) |
| InChIKey | DQEDTXFDRNONKW-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |