C9H10F3NO4S2 — CID 113326823
3-(4,4,4-trifluorobutylsulfamoyl)thiophene-2-carboxylic acid (PubChem CID 113326823) has the molecular formula C9H10F3NO4S2 and a molecular weight of 317.31 g/mol. Its IUPAC name is 3-(4,4,4-trifluorobutylsulfamoyl)thiophene-2-carboxylic acid.
| Compound Name | 3-(4,4,4-trifluorobutylsulfamoyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 113326823 |
| Molecular Formula | C9H10F3NO4S2 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | 3-(4,4,4-trifluorobutylsulfamoyl)thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sccc1S(=O)(=O)NCCCC(F)(F)F |
| InChI | InChI=1S/C9H10F3NO4S2/c10-9(11,12)3-1-4-13-19(16,17)6-2-5-18-7(6)8(14)15/h2,5,13H,1,3-4H2,(H,14,15) |
| InChIKey | MENCQLUVXNHOEY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|