C11H11BrF3NO4S — CID 115515879
4-bromo-3-(4,4,4-trifluorobutylsulfamoyl)benzoic acid (PubChem CID 115515879) has the molecular formula C11H11BrF3NO4S and a molecular weight of 390.18 g/mol. Its IUPAC name is 4-bromo-3-(4,4,4-trifluorobutylsulfamoyl)benzoic acid.
| Compound Name | 4-bromo-3-(4,4,4-trifluorobutylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 115515879 |
| Molecular Formula | C11H11BrF3NO4S |
| Molecular Weight | 390.18 g/mol |
| Exact Mass | 388.95 |
| IUPAC Name | 4-bromo-3-(4,4,4-trifluorobutylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1ccc(Br)c(S(=O)(=O)NCCCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H11BrF3NO4S/c12-8-3-2-7(10(17)18)6-9(8)21(19,20)16-5-1-4-11(13,14)15/h2-3,6,16H,1,4-5H2,(H,17,18) |
| InChIKey | AZPOWSVTRCSNKZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.18 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|