C13H10F3N2O4S2- — CID 162773483
1-[[4-(sulfinatoamino)phenyl]sulfonylamino]-3-(trifluoromethyl)benzene (PubChem CID 162773483) has the molecular formula C13H10F3N2O4S2- and a molecular weight of 379.36 g/mol. Its IUPAC name is 1-[[4-(sulfinatoamino)phenyl]sulfonylamino]-3-(trifluoromethyl)benzene.
| Compound Name | 1-[[4-(sulfinatoamino)phenyl]sulfonylamino]-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 162773483 |
| Molecular Formula | C13H10F3N2O4S2- |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | 1-[[4-(sulfinatoamino)phenyl]sulfonylamino]-3-(trifluoromethyl)benzene |
| SMILES | O=S([O-])Nc1ccc(S(=O)(=O)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C13H11F3N2O4S2/c14-13(15,16)9-2-1-3-11(8-9)18-24(21,22)12-6-4-10(5-7-12)17-23(19)20/h1-8,17-18H,(H,19,20)/p-1 |
| InChIKey | IFROLGZOJIQWFN-UHFFFAOYSA-M |
| XLogP | 2.71 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|