C12H5F6NO2S — CID 134093089
2,3,4,5,6-pentafluoro-N-(2-fluorophenyl)benzenesulfonamide (PubChem CID 134093089) has the molecular formula C12H5F6NO2S and a molecular weight of 341.23 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-(2-fluorophenyl)benzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-(2-fluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 134093089 |
| Molecular Formula | C12H5F6NO2S |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-(2-fluorophenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H5F6NO2S/c13-5-3-1-2-4-6(5)19-22(20,21)12-10(17)8(15)7(14)9(16)11(12)18/h1-4,19H |
| InChIKey | HHJUJXWQGZASST-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|