C13H8F3NO4S — CID 71269303
3-[(2,6-difluorophenyl)sulfonylamino]-2-fluorobenzoic acid (PubChem CID 71269303) has the molecular formula C13H8F3NO4S and a molecular weight of 331.27 g/mol. Its IUPAC name is 3-[(2,6-difluorophenyl)sulfonylamino]-2-fluorobenzoic acid.
| Compound Name | 3-[(2,6-difluorophenyl)sulfonylamino]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 71269303 |
| Molecular Formula | C13H8F3NO4S |
| Molecular Weight | 331.27 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | 3-[(2,6-difluorophenyl)sulfonylamino]-2-fluorobenzoic acid |
| SMILES | O=C(O)c1cccc(NS(=O)(=O)c2c(F)cccc2F)c1F |
| InChI | InChI=1S/C13H8F3NO4S/c14-8-4-2-5-9(15)12(8)22(20,21)17-10-6-1-3-7(11(10)16)13(18)19/h1-6,17H,(H,18,19) |
| InChIKey | NNHUUSVTTOKPAY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |