C10H7F2N3O4S — CID 61075738
5-[(2,3-difluorophenyl)sulfamoyl]-1H-pyrazole-4-carboxylic acid (PubChem CID 61075738) has the molecular formula C10H7F2N3O4S and a molecular weight of 303.25 g/mol. Its IUPAC name is 5-[(2,3-difluorophenyl)sulfamoyl]-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-[(2,3-difluorophenyl)sulfamoyl]-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 61075738 |
| Molecular Formula | C10H7F2N3O4S |
| Molecular Weight | 303.25 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 5-[(2,3-difluorophenyl)sulfamoyl]-1H-pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn[nH]c1S(=O)(=O)Nc1cccc(F)c1F |
| InChI | InChI=1S/C10H7F2N3O4S/c11-6-2-1-3-7(8(6)12)15-20(18,19)9-5(10(16)17)4-13-14-9/h1-4,15H,(H,13,14)(H,16,17) |
| InChIKey | QRFHAVWIFYLNOH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |