C10H6Cl2FN3O4S — CID 107571644
5-[(3,5-dichloro-4-fluorophenyl)sulfamoyl]-1H-pyrazole-4-carboxylic acid (PubChem CID 107571644) has the molecular formula C10H6Cl2FN3O4S and a molecular weight of 354.15 g/mol. Its IUPAC name is 5-[(3,5-dichloro-4-fluorophenyl)sulfamoyl]-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-[(3,5-dichloro-4-fluorophenyl)sulfamoyl]-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 107571644 |
| Molecular Formula | C10H6Cl2FN3O4S |
| Molecular Weight | 354.15 g/mol |
| Exact Mass | 352.94 |
| IUPAC Name | 5-[(3,5-dichloro-4-fluorophenyl)sulfamoyl]-1H-pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn[nH]c1S(=O)(=O)Nc1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C10H6Cl2FN3O4S/c11-6-1-4(2-7(12)8(6)13)16-21(19,20)9-5(10(17)18)3-14-15-9/h1-3,16H,(H,14,15)(H,17,18) |
| InChIKey | PNXNIQUZCVZESI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.15 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|