C16H13ClN4O3S — CID 53115439
N-(3-chlorophenyl)-5-(phenylsulfamoyl)-1H-pyrazole-4-carboxamide (PubChem CID 53115439) has the molecular formula C16H13ClN4O3S and a molecular weight of 376.83 g/mol. Its IUPAC name is N-(3-chlorophenyl)-5-(phenylsulfamoyl)-1H-pyrazole-4-carboxamide.
| Compound Name | N-(3-chlorophenyl)-5-(phenylsulfamoyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 53115439 |
| Molecular Formula | C16H13ClN4O3S |
| Molecular Weight | 376.83 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | N-(3-chlorophenyl)-5-(phenylsulfamoyl)-1H-pyrazole-4-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1cn[nH]c1S(=O)(=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H13ClN4O3S/c17-11-5-4-8-13(9-11)19-15(22)14-10-18-20-16(14)25(23,24)21-12-6-2-1-3-7-12/h1-10,21H,(H,18,20)(H,19,22) |
| InChIKey | IFIRIJITXJIFMW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.83 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |