C18H17ClN4O4S — CID 53115668
N-[(3-chlorophenyl)methyl]-5-[(4-methoxyphenyl)sulfamoyl]-1H-pyrazole-4-carboxamide (PubChem CID 53115668) has the molecular formula C18H17ClN4O4S and a molecular weight of 420.88 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-5-[(4-methoxyphenyl)sulfamoyl]-1H-pyrazole-4-carboxamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-5-[(4-methoxyphenyl)sulfamoyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 53115668 |
| Molecular Formula | C18H17ClN4O4S |
| Molecular Weight | 420.88 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-5-[(4-methoxyphenyl)sulfamoyl]-1H-pyrazole-4-carboxamide |
| SMILES | COc1ccc(NS(=O)(=O)c2[nH]ncc2C(=O)NCc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C18H17ClN4O4S/c1-27-15-7-5-14(6-8-15)23-28(25,26)18-16(11-21-22-18)17(24)20-10-12-3-2-4-13(19)9-12/h2-9,11,23H,10H2,1H3,(H,20,24)(H,21,22) |
| InChIKey | IWYMIXQUVVYHJH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.88 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |