C19H18N4O6S — CID 53115536
methyl 4-[[5-[(4-methoxyphenyl)sulfamoyl]-1H-pyrazole-4-carbonyl]amino]benzoate (PubChem CID 53115536) has the molecular formula C19H18N4O6S and a molecular weight of 430.44 g/mol. Its IUPAC name is methyl 4-[[5-[(4-methoxyphenyl)sulfamoyl]-1H-pyrazole-4-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[5-[(4-methoxyphenyl)sulfamoyl]-1H-pyrazole-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 53115536 |
| Molecular Formula | C19H18N4O6S |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | methyl 4-[[5-[(4-methoxyphenyl)sulfamoyl]-1H-pyrazole-4-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2cn[nH]c2S(=O)(=O)Nc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C19H18N4O6S/c1-28-15-9-7-14(8-10-15)23-30(26,27)18-16(11-20-22-18)17(24)21-13-5-3-12(4-6-13)19(25)29-2/h3-11,23H,1-2H3,(H,20,22)(H,21,24) |
| InChIKey | BSDKCONVSOTGFI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |