C16H15N5O5S2 — CID 53115449
5-(phenylsulfamoyl)-N-(4-sulfamoylphenyl)-1H-pyrazole-4-carboxamide (PubChem CID 53115449) has the molecular formula C16H15N5O5S2 and a molecular weight of 421.46 g/mol. Its IUPAC name is 5-(phenylsulfamoyl)-N-(4-sulfamoylphenyl)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-(phenylsulfamoyl)-N-(4-sulfamoylphenyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 53115449 |
| Molecular Formula | C16H15N5O5S2 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | 5-(phenylsulfamoyl)-N-(4-sulfamoylphenyl)-1H-pyrazole-4-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2cn[nH]c2S(=O)(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C16H15N5O5S2/c17-27(23,24)13-8-6-11(7-9-13)19-15(22)14-10-18-20-16(14)28(25,26)21-12-4-2-1-3-5-12/h1-10,21H,(H,18,20)(H,19,22)(H2,17,23,24) |
| InChIKey | KBVYPUAZEWRZGA-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 164.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |