C10H11N5O3S — CID 63104822
4-amino-N-(4-sulfamoylphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 63104822) has the molecular formula C10H11N5O3S and a molecular weight of 281.30 g/mol. Its IUPAC name is 4-amino-N-(4-sulfamoylphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 4-amino-N-(4-sulfamoylphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 63104822 |
| Molecular Formula | C10H11N5O3S |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 4-amino-N-(4-sulfamoylphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | Nc1cn[nH]c1C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C10H11N5O3S/c11-8-5-13-15-9(8)10(16)14-6-1-3-7(4-2-6)19(12,17)18/h1-5H,11H2,(H,13,15)(H,14,16)(H2,12,17,18) |
| InChIKey | XCLDZEPARPSNMO-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 143.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |