C18H15F3N4O4S — CID 53115477
5-[(4-methylphenyl)sulfamoyl]-N-[3-(trifluoromethoxy)phenyl]-1H-pyrazole-4-carboxamide (PubChem CID 53115477) has the molecular formula C18H15F3N4O4S and a molecular weight of 440.40 g/mol. Its IUPAC name is 5-[(4-methylphenyl)sulfamoyl]-N-[3-(trifluoromethoxy)phenyl]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-[(4-methylphenyl)sulfamoyl]-N-[3-(trifluoromethoxy)phenyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 53115477 |
| Molecular Formula | C18H15F3N4O4S |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 5-[(4-methylphenyl)sulfamoyl]-N-[3-(trifluoromethoxy)phenyl]-1H-pyrazole-4-carboxamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2[nH]ncc2C(=O)Nc2cccc(OC(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H15F3N4O4S/c1-11-5-7-12(8-6-11)25-30(27,28)17-15(10-22-24-17)16(26)23-13-3-2-4-14(9-13)29-18(19,20)21/h2-10,25H,1H3,(H,22,24)(H,23,26) |
| InChIKey | SBMLLAOBYIWHTF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |