C17H15FN4O4S — CID 53115538
N-(3-fluorophenyl)-5-[(4-methoxyphenyl)sulfamoyl]-1H-pyrazole-4-carboxamide (PubChem CID 53115538) has the molecular formula C17H15FN4O4S and a molecular weight of 390.40 g/mol. Its IUPAC name is N-(3-fluorophenyl)-5-[(4-methoxyphenyl)sulfamoyl]-1H-pyrazole-4-carboxamide.
| Compound Name | N-(3-fluorophenyl)-5-[(4-methoxyphenyl)sulfamoyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 53115538 |
| Molecular Formula | C17H15FN4O4S |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | N-(3-fluorophenyl)-5-[(4-methoxyphenyl)sulfamoyl]-1H-pyrazole-4-carboxamide |
| SMILES | COc1ccc(NS(=O)(=O)c2[nH]ncc2C(=O)Nc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C17H15FN4O4S/c1-26-14-7-5-12(6-8-14)22-27(24,25)17-15(10-19-21-17)16(23)20-13-4-2-3-11(18)9-13/h2-10,22H,1H3,(H,19,21)(H,20,23) |
| InChIKey | BGSBXZXJUVFLSK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |