C10H6F3N3O4S — CID 60911015
5-[(2,3,4-trifluorophenyl)sulfamoyl]-1H-pyrazole-4-carboxylic acid (PubChem CID 60911015) has the molecular formula C10H6F3N3O4S and a molecular weight of 321.24 g/mol. Its IUPAC name is 5-[(2,3,4-trifluorophenyl)sulfamoyl]-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-[(2,3,4-trifluorophenyl)sulfamoyl]-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 60911015 |
| Molecular Formula | C10H6F3N3O4S |
| Molecular Weight | 321.24 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | 5-[(2,3,4-trifluorophenyl)sulfamoyl]-1H-pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn[nH]c1S(=O)(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C10H6F3N3O4S/c11-5-1-2-6(8(13)7(5)12)16-21(19,20)9-4(10(17)18)3-14-15-9/h1-3,16H,(H,14,15)(H,17,18) |
| InChIKey | QIPVGLJSKTZFIV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|