C12H14N4O4S — CID 61403636
5-[[2-(methylaminomethyl)phenyl]sulfamoyl]-1H-pyrazole-4-carboxylic acid (PubChem CID 61403636) has the molecular formula C12H14N4O4S and a molecular weight of 310.34 g/mol. Its IUPAC name is 5-[[2-(methylaminomethyl)phenyl]sulfamoyl]-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-[[2-(methylaminomethyl)phenyl]sulfamoyl]-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 61403636 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 5-[[2-(methylaminomethyl)phenyl]sulfamoyl]-1H-pyrazole-4-carboxylic acid |
| SMILES | CNCc1ccccc1NS(=O)(=O)c1[nH]ncc1C(=O)O |
| InChI | InChI=1S/C12H14N4O4S/c1-13-6-8-4-2-3-5-10(8)16-21(19,20)11-9(12(17)18)7-14-15-11/h2-5,7,13,16H,6H2,1H3,(H,14,15)(H,17,18) |
| InChIKey | MNVLKYAEKBQZQR-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |