C12H12IN3O4S — CID 60712737
ethyl 5-[(2-iodophenyl)sulfamoyl]-1H-pyrazole-4-carboxylate (PubChem CID 60712737) has the molecular formula C12H12IN3O4S and a molecular weight of 421.22 g/mol. Its IUPAC name is ethyl 5-[(2-iodophenyl)sulfamoyl]-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(2-iodophenyl)sulfamoyl]-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 60712737 |
| Molecular Formula | C12H12IN3O4S |
| Molecular Weight | 421.22 g/mol |
| Exact Mass | 420.96 |
| IUPAC Name | ethyl 5-[(2-iodophenyl)sulfamoyl]-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1S(=O)(=O)Nc1ccccc1I |
| InChI | InChI=1S/C12H12IN3O4S/c1-2-20-12(17)8-7-14-15-11(8)21(18,19)16-10-6-4-3-5-9(10)13/h3-7,16H,2H2,1H3,(H,14,15) |
| InChIKey | WRVPBTKWHPZBEH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.22 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|