C14H16N4O5S — CID 46514340
ethyl 5-[[3-(methylcarbamoyl)phenyl]sulfamoyl]-1H-pyrazole-4-carboxylate (PubChem CID 46514340) has the molecular formula C14H16N4O5S and a molecular weight of 352.37 g/mol. Its IUPAC name is ethyl 5-[[3-(methylcarbamoyl)phenyl]sulfamoyl]-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-[[3-(methylcarbamoyl)phenyl]sulfamoyl]-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 46514340 |
| Molecular Formula | C14H16N4O5S |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | ethyl 5-[[3-(methylcarbamoyl)phenyl]sulfamoyl]-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1S(=O)(=O)Nc1cccc(C(=O)NC)c1 |
| InChI | InChI=1S/C14H16N4O5S/c1-3-23-14(20)11-8-16-17-13(11)24(21,22)18-10-6-4-5-9(7-10)12(19)15-2/h4-8,18H,3H2,1-2H3,(H,15,19)(H,16,17) |
| InChIKey | RSCZMNBANMQXAA-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |