C11H11FN4O4S — CID 103775663
ethyl 5-[(6-fluoro-3-pyridinyl)sulfamoyl]-1H-pyrazole-4-carboxylate (PubChem CID 103775663) has the molecular formula C11H11FN4O4S and a molecular weight of 314.30 g/mol. Its IUPAC name is ethyl 5-[(6-fluoro-3-pyridinyl)sulfamoyl]-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(6-fluoro-3-pyridinyl)sulfamoyl]-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 103775663 |
| Molecular Formula | C11H11FN4O4S |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | ethyl 5-[(6-fluoro-3-pyridinyl)sulfamoyl]-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1S(=O)(=O)Nc1ccc(F)nc1 |
| InChI | InChI=1S/C11H11FN4O4S/c1-2-20-11(17)8-6-14-15-10(8)21(18,19)16-7-3-4-9(12)13-5-7/h3-6,16H,2H2,1H3,(H,14,15) |
| InChIKey | QZRXWHACAIWULN-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|