C13H14ClN3O4S — CID 27372846
ethyl 5-[(2-chloro-4-methylphenyl)sulfamoyl]-1H-pyrazole-4-carboxylate (PubChem CID 27372846) has the molecular formula C13H14ClN3O4S and a molecular weight of 343.79 g/mol. Its IUPAC name is ethyl 5-[(2-chloro-4-methylphenyl)sulfamoyl]-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(2-chloro-4-methylphenyl)sulfamoyl]-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 27372846 |
| Molecular Formula | C13H14ClN3O4S |
| Molecular Weight | 343.79 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | ethyl 5-[(2-chloro-4-methylphenyl)sulfamoyl]-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1S(=O)(=O)Nc1ccc(C)cc1Cl |
| InChI | InChI=1S/C13H14ClN3O4S/c1-3-21-13(18)9-7-15-16-12(9)22(19,20)17-11-5-4-8(2)6-10(11)14/h4-7,17H,3H2,1-2H3,(H,15,16) |
| InChIKey | KODBUIMRPICQNB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.79 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |