C11H13N5O4S — CID 60912283
5-[[2-(dimethylamino)-3-pyridinyl]sulfamoyl]-1H-pyrazole-4-carboxylic acid (PubChem CID 60912283) has the molecular formula C11H13N5O4S and a molecular weight of 311.32 g/mol. Its IUPAC name is 5-[[2-(dimethylamino)-3-pyridinyl]sulfamoyl]-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-[[2-(dimethylamino)-3-pyridinyl]sulfamoyl]-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 60912283 |
| Molecular Formula | C11H13N5O4S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 5-[[2-(dimethylamino)-3-pyridinyl]sulfamoyl]-1H-pyrazole-4-carboxylic acid |
| SMILES | CN(C)c1ncccc1NS(=O)(=O)c1[nH]ncc1C(=O)O |
| InChI | InChI=1S/C11H13N5O4S/c1-16(2)9-8(4-3-5-12-9)15-21(19,20)10-7(11(17)18)6-13-14-10/h3-6,15H,1-2H3,(H,13,14)(H,17,18) |
| InChIKey | XBBVVXVNJPIQOF-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |