C11H17N3O4S — CID 43710941
4-[[2-(dimethylamino)-3-pyridinyl]sulfamoyl]butanoic acid (PubChem CID 43710941) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is 4-[[2-(dimethylamino)-3-pyridinyl]sulfamoyl]butanoic acid.
| Compound Name | 4-[[2-(dimethylamino)-3-pyridinyl]sulfamoyl]butanoic acid |
|---|---|
| PubChem CID | 43710941 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 4-[[2-(dimethylamino)-3-pyridinyl]sulfamoyl]butanoic acid |
| SMILES | CN(C)c1ncccc1NS(=O)(=O)CCCC(=O)O |
| InChI | InChI=1S/C11H17N3O4S/c1-14(2)11-9(5-3-7-12-11)13-19(17,18)8-4-6-10(15)16/h3,5,7,13H,4,6,8H2,1-2H3,(H,15,16) |
| InChIKey | NRUQQEKQSFSXDB-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |