C8H14N4O4S — CID 54933878
5-[2-(dimethylamino)ethylsulfamoyl]-1H-pyrazole-4-carboxylic acid (PubChem CID 54933878) has the molecular formula C8H14N4O4S and a molecular weight of 262.29 g/mol. Its IUPAC name is 5-[2-(dimethylamino)ethylsulfamoyl]-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-[2-(dimethylamino)ethylsulfamoyl]-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 54933878 |
| Molecular Formula | C8H14N4O4S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 5-[2-(dimethylamino)ethylsulfamoyl]-1H-pyrazole-4-carboxylic acid |
| SMILES | CN(C)CCNS(=O)(=O)c1[nH]ncc1C(=O)O |
| InChI | InChI=1S/C8H14N4O4S/c1-12(2)4-3-10-17(15,16)7-6(8(13)14)5-9-11-7/h5,10H,3-4H2,1-2H3,(H,9,11)(H,13,14) |
| InChIKey | IPURMPGBUQVZIY-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 115.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |