C17H20FNO2S — CID 22773407
N-(2-fluorophenyl)-2,3,4,5,6-pentamethylbenzenesulfonamide (PubChem CID 22773407) has the molecular formula C17H20FNO2S and a molecular weight of 321.42 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2,3,4,5,6-pentamethylbenzenesulfonamide.
| Compound Name | N-(2-fluorophenyl)-2,3,4,5,6-pentamethylbenzenesulfonamide |
|---|---|
| PubChem CID | 22773407 |
| Molecular Formula | C17H20FNO2S |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | N-(2-fluorophenyl)-2,3,4,5,6-pentamethylbenzenesulfonamide |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)Nc2ccccc2F)c(C)c1C |
| InChI | InChI=1S/C17H20FNO2S/c1-10-11(2)13(4)17(14(5)12(10)3)22(20,21)19-16-9-7-6-8-15(16)18/h6-9,19H,1-5H3 |
| InChIKey | VTSWDIUUPHWBET-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |