C13H6F15NO4S2 — CID 166690684
N-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]sulfonyl-3-(2,2,2-trifluoroethyl)-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 166690684) has the molecular formula C13H6F15NO4S2 and a molecular weight of 589.30 g/mol. Its IUPAC name is N-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]sulfonyl-3-(2,2,2-trifluoroethyl)-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]sulfonyl-3-(2,2,2-trifluoroethyl)-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 166690684 |
| Molecular Formula | C13H6F15NO4S2 |
| Molecular Weight | 589.30 g/mol |
| Exact Mass | 588.95 |
| IUPAC Name | N-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]sulfonyl-3-(2,2,2-trifluoroethyl)-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NS(=O)(=O)C(C(F)(F)F)(C(F)(F)F)C(F)(F)F)c1cc(CC(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H6F15NO4S2/c14-8(15,16)4-5-1-6(9(17,18)19)3-7(2-5)34(30,31)29-35(32,33)10(11(20,21)22,12(23,24)25)13(26,27)28/h1-3,29H,4H2 |
| InChIKey | WCJOWWHKRTYDJT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.30 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |